C10H20 — CID 142997772
ethane;(5Z)-5-methylhepta-1,5-diene (PubChem CID 142997772) has the molecular formula C10H20 and a molecular weight of 140.27 g/mol. Its IUPAC name is ethane;(5Z)-5-methylhepta-1,5-diene.
| Compound Name | ethane;(5Z)-5-methylhepta-1,5-diene |
|---|---|
| PubChem CID | 142997772 |
| Molecular Formula | C10H20 |
| Molecular Weight | 140.27 g/mol |
| Exact Mass | 140.16 |
| IUPAC Name | ethane;(5Z)-5-methylhepta-1,5-diene |
| SMILES | C=CCC/C(C)=C\C.CC |
| InChI | InChI=1S/C8H14.C2H6/c1-4-6-7-8(3)5-2;1-2/h4-5H,1,6-7H2,2-3H3;1-2H3/b8-5-; |
| InChIKey | ZKKNVXZIZSGNBH-HGKIGUAWSA-N |
| XLogP | 3.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.27 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|