C12H24 — CID 142226106
ethane;(5E)-5-propan-2-ylhepta-1,5-diene (PubChem CID 142226106) has the molecular formula C12H24 and a molecular weight of 168.32 g/mol. Its IUPAC name is ethane;(5E)-5-propan-2-ylhepta-1,5-diene.
| Compound Name | ethane;(5E)-5-propan-2-ylhepta-1,5-diene |
|---|---|
| PubChem CID | 142226106 |
| Molecular Formula | C12H24 |
| Molecular Weight | 168.32 g/mol |
| Exact Mass | 168.19 |
| IUPAC Name | ethane;(5E)-5-propan-2-ylhepta-1,5-diene |
| SMILES | C=CCC/C(=C\C)C(C)C.CC |
| InChI | InChI=1S/C10H18.C2H6/c1-5-7-8-10(6-2)9(3)4;1-2/h5-6,9H,1,7-8H2,2-4H3;1-2H3/b10-6+; |
| InChIKey | QYPPASJHHQNPJP-AAGWESIMSA-N |
| XLogP | 4.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.32 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|