C9H20 — CID 144513072
ethane;2-methylhexa-1,5-diene;molecular hydrogen (PubChem CID 144513072) has the molecular formula C9H20 and a molecular weight of 128.26 g/mol. Its IUPAC name is ethane;2-methylhexa-1,5-diene;molecular hydrogen.
| Compound Name | ethane;2-methylhexa-1,5-diene;molecular hydrogen |
|---|---|
| PubChem CID | 144513072 |
| Molecular Formula | C9H20 |
| Molecular Weight | 128.26 g/mol |
| Exact Mass | 128.16 |
| IUPAC Name | ethane;2-methylhexa-1,5-diene;molecular hydrogen |
| SMILES | C=CCCC(=C)C.CC.[H][H] |
| InChI | InChI=1S/C7H12.C2H6.H2/c1-4-5-6-7(2)3;1-2;/h4H,1-2,5-6H2,3H3;1-2H3;1H |
| InChIKey | KMJBQXRPFGRJOY-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.26 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|