C11H18 — CID 163214311
2-methyldeca-1,5,9-triene (PubChem CID 163214311) has the molecular formula C11H18 and a molecular weight of 150.26 g/mol. Its IUPAC name is 2-methyldeca-1,5,9-triene.
| Compound Name | 2-methyldeca-1,5,9-triene |
|---|---|
| PubChem CID | 163214311 |
| Molecular Formula | C11H18 |
| Molecular Weight | 150.26 g/mol |
| Exact Mass | 150.14 |
| IUPAC Name | 2-methyldeca-1,5,9-triene |
| SMILES | C=CCCC=CCCC(=C)C |
| InChI | InChI=1S/C11H18/c1-4-5-6-7-8-9-10-11(2)3/h4,7-8H,1-2,5-6,9-10H2,3H3 |
| InChIKey | LULCYSOEQHCJFA-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.26 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|