C22H36 — CID 138968984
(5E,9E,13E)-5,13,18-trimethylnonadeca-1,5,9,13,17-pentaene (PubChem CID 138968984) has the molecular formula C22H36 and a molecular weight of 300.53 g/mol. Its IUPAC name is (5E,9E,13E)-5,13,18-trimethylnonadeca-1,5,9,13,17-pentaene.
| Compound Name | (5E,9E,13E)-5,13,18-trimethylnonadeca-1,5,9,13,17-pentaene |
|---|---|
| PubChem CID | 138968984 |
| Molecular Formula | C22H36 |
| Molecular Weight | 300.53 g/mol |
| Exact Mass | 300.28 |
| IUPAC Name | (5E,9E,13E)-5,13,18-trimethylnonadeca-1,5,9,13,17-pentaene |
| SMILES | C=CCC/C(C)=C/CC/C=C/CC/C(C)=C/CCC=C(C)C |
| InChI | InChI=1S/C22H36/c1-6-7-16-21(4)17-11-9-8-10-12-18-22(5)19-14-13-15-20(2)3/h6,8,10,15,17,19H,1,7,9,11-14,16,18H2,2-5H3/b10-8+,21-17+,22-19+ |
| InChIKey | YPIMMNKTXJZSAI-XGUXCWTOSA-N |
| XLogP | 7.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.53 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|