C31H50 — CID 101345792
(6Z,10E,14E,18E)-6-ethenyl-2,10,15,19,23-pentamethyltetracosa-2,6,10,14,18,22-hexaene (PubChem CID 101345792) has the molecular formula C31H50 and a molecular weight of 422.74 g/mol. Its IUPAC name is (6Z,10E,14E,18E)-6-ethenyl-2,10,15,19,23-pentamethyltetracosa-2,6,10,14,18,22-hexaene.
| Compound Name | (6Z,10E,14E,18E)-6-ethenyl-2,10,15,19,23-pentamethyltetracosa-2,6,10,14,18,22-hexaene |
|---|---|
| PubChem CID | 101345792 |
| Molecular Formula | C31H50 |
| Molecular Weight | 422.74 g/mol |
| Exact Mass | 422.39 |
| IUPAC Name | (6Z,10E,14E,18E)-6-ethenyl-2,10,15,19,23-pentamethyltetracosa-2,6,10,14,18,22-hexaene |
| SMILES | C=C/C(=C\CC/C(C)=C/CC/C=C(\C)CC/C=C(\C)CCC=C(C)C)CCC=C(C)C |
| InChI | InChI=1S/C31H50/c1-9-31(24-13-17-27(4)5)25-15-23-29(7)19-11-10-18-28(6)21-14-22-30(8)20-12-16-26(2)3/h9,16-19,22,25H,1,10-15,20-21,23-24H2,2-8H3/b28-18+,29-19+,30-22+,31-25+ |
| InChIKey | KPANOGVATNSLAT-BFNTZYCTSA-N |
| XLogP | 10.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.74 |
| LogP ≤ 5 | 10.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|