C30H48 — CID 158652324
7,11-dimethyl-3-methylidenedodeca-1,6,10-triene (PubChem CID 158652324) has the molecular formula C30H48 and a molecular weight of 408.71 g/mol. Its IUPAC name is 7,11-dimethyl-3-methylidenedodeca-1,6,10-triene.
| Compound Name | 7,11-dimethyl-3-methylidenedodeca-1,6,10-triene |
|---|---|
| PubChem CID | 158652324 |
| Molecular Formula | C30H48 |
| Molecular Weight | 408.71 g/mol |
| Exact Mass | 408.38 |
| IUPAC Name | 7,11-dimethyl-3-methylidenedodeca-1,6,10-triene |
| SMILES | C=CC(=C)CCC=C(C)CCC=C(C)C.C=CC(=C)CCC=C(C)CCC=C(C)C |
| InChI | InChI=1S/2C15H24/c2*1-6-14(4)10-8-12-15(5)11-7-9-13(2)3/h2*6,9,12H,1,4,7-8,10-11H2,2-3,5H3 |
| InChIKey | IBRZMSRKXBEGNR-UHFFFAOYSA-N |
| XLogP | 10.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.71 |
| LogP ≤ 5 | 10.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|