C16H26 — CID 6443227
(3E,7E)-4,8,12-trimethyltrideca-1,3,7,11-tetraene (PubChem CID 6443227) has the molecular formula C16H26 and a molecular weight of 218.38 g/mol. Its IUPAC name is (3E,7E)-4,8,12-trimethyltrideca-1,3,7,11-tetraene.
| Compound Name | (3E,7E)-4,8,12-trimethyltrideca-1,3,7,11-tetraene |
|---|---|
| PubChem CID | 6443227 |
| Molecular Formula | C16H26 |
| Molecular Weight | 218.38 g/mol |
| Exact Mass | 218.20 |
| IUPAC Name | (3E,7E)-4,8,12-trimethyltrideca-1,3,7,11-tetraene |
| SMILES | C=C/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C16H26/c1-6-9-15(4)12-8-13-16(5)11-7-10-14(2)3/h6,9-10,13H,1,7-8,11-12H2,2-5H3/b15-9+,16-13+ |
| InChIKey | CWLVBFJCJXHUCF-RNPYNJAESA-N |
| XLogP | 5.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.38 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|