C13H20O2 — CID 87385613
(2E)-3,7-dimethylocta-2,6-dienal;prop-2-enal (PubChem CID 87385613) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is (2E)-3,7-dimethylocta-2,6-dienal;prop-2-enal.
| Compound Name | (2E)-3,7-dimethylocta-2,6-dienal;prop-2-enal |
|---|---|
| PubChem CID | 87385613 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | (2E)-3,7-dimethylocta-2,6-dienal;prop-2-enal |
| SMILES | C=CC=O.CC(C)=CCC/C(C)=C/C=O |
| InChI | InChI=1S/C10H16O.C3H4O/c1-9(2)5-4-6-10(3)7-8-11;1-2-3-4/h5,7-8H,4,6H2,1-3H3;2-3H,1H2/b10-7+; |
| InChIKey | SPMUMYHVTKPILC-HCUGZAAXSA-N |
| XLogP | 3.25 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|