C19H38O6 — CID 88617273
1,1-diethoxyethane;3,7-dimethylocta-2,6-dienal;propane-1,2,3-triol (PubChem CID 88617273) has the molecular formula C19H38O6 and a molecular weight of 362.51 g/mol. Its IUPAC name is 1,1-diethoxyethane;3,7-dimethylocta-2,6-dienal;propane-1,2,3-triol.
| Compound Name | 1,1-diethoxyethane;3,7-dimethylocta-2,6-dienal;propane-1,2,3-triol |
|---|---|
| PubChem CID | 88617273 |
| Molecular Formula | C19H38O6 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.27 |
| IUPAC Name | 1,1-diethoxyethane;3,7-dimethylocta-2,6-dienal;propane-1,2,3-triol |
| SMILES | CC(C)=CCCC(C)=CC=O.CCOC(C)OCC.OCC(O)CO |
| InChI | InChI=1S/C10H16O.C6H14O2.C3H8O3/c1-9(2)5-4-6-10(3)7-8-11;1-4-7-6(3)8-5-2;4-1-3(6)2-5/h5,7-8H,4,6H2,1-3H3;6H,4-5H2,1-3H3;3-6H,1-2H2 |
| InChIKey | ITMJNEZUCSZFKW-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|