C11H26O5 — CID 87169922
acetaldehyde;1,1-diethoxyethane;propane-1,2-diol (PubChem CID 87169922) has the molecular formula C11H26O5 and a molecular weight of 238.32 g/mol. Its IUPAC name is acetaldehyde;1,1-diethoxyethane;propane-1,2-diol.
| Compound Name | acetaldehyde;1,1-diethoxyethane;propane-1,2-diol |
|---|---|
| PubChem CID | 87169922 |
| Molecular Formula | C11H26O5 |
| Molecular Weight | 238.32 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | acetaldehyde;1,1-diethoxyethane;propane-1,2-diol |
| SMILES | CC(O)CO.CC=O.CCOC(C)OCC |
| InChI | InChI=1S/C6H14O2.C3H8O2.C2H4O/c1-4-7-6(3)8-5-2;1-3(5)2-4;1-2-3/h6H,4-5H2,1-3H3;3-5H,2H2,1H3;2H,1H3 |
| InChIKey | YQGCIDYZZPBDJA-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.32 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|