C19H34O5 — CID 87322868
acetaldehyde;1,1-diethoxyethane;2-phenylpentane-2,4-diol (PubChem CID 87322868) has the molecular formula C19H34O5 and a molecular weight of 342.48 g/mol. Its IUPAC name is acetaldehyde;1,1-diethoxyethane;2-phenylpentane-2,4-diol.
| Compound Name | acetaldehyde;1,1-diethoxyethane;2-phenylpentane-2,4-diol |
|---|---|
| PubChem CID | 87322868 |
| Molecular Formula | C19H34O5 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | acetaldehyde;1,1-diethoxyethane;2-phenylpentane-2,4-diol |
| SMILES | CC(O)CC(C)(O)c1ccccc1.CC=O.CCOC(C)OCC |
| InChI | InChI=1S/C11H16O2.C6H14O2.C2H4O/c1-9(12)8-11(2,13)10-6-4-3-5-7-10;1-4-7-6(3)8-5-2;1-2-3/h3-7,9,12-13H,8H2,1-2H3;6H,4-5H2,1-3H3;2H,1H3 |
| InChIKey | MCPXYPLFBSGQNG-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|