C18H32O5 — CID 88673769
benzaldehyde;1,1-diethoxyethane;2,2-dimethylpropane-1,1-diol (PubChem CID 88673769) has the molecular formula C18H32O5 and a molecular weight of 328.45 g/mol. Its IUPAC name is benzaldehyde;1,1-diethoxyethane;2,2-dimethylpropane-1,1-diol.
| Compound Name | benzaldehyde;1,1-diethoxyethane;2,2-dimethylpropane-1,1-diol |
|---|---|
| PubChem CID | 88673769 |
| Molecular Formula | C18H32O5 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | benzaldehyde;1,1-diethoxyethane;2,2-dimethylpropane-1,1-diol |
| SMILES | CC(C)(C)C(O)O.CCOC(C)OCC.O=Cc1ccccc1 |
| InChI | InChI=1S/C7H6O.C6H14O2.C5H12O2/c8-6-7-4-2-1-3-5-7;1-4-7-6(3)8-5-2;1-5(2,3)4(6)7/h1-6H;6H,4-5H2,1-3H3;4,6-7H,1-3H3 |
| InChIKey | VVXXEEPLHXTQLO-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|