C20H28O2 — CID 66689331
1,1-diethoxyethane;2-phenylethylbenzene (PubChem CID 66689331) has the molecular formula C20H28O2 and a molecular weight of 300.44 g/mol. Its IUPAC name is 1,1-diethoxyethane;2-phenylethylbenzene.
| Compound Name | 1,1-diethoxyethane;2-phenylethylbenzene |
|---|---|
| PubChem CID | 66689331 |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | 1,1-diethoxyethane;2-phenylethylbenzene |
| SMILES | CCOC(C)OCC.c1ccc(CCc2ccccc2)cc1 |
| InChI | InChI=1S/C14H14.C6H14O2/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;1-4-7-6(3)8-5-2/h1-10H,11-12H2;6H,4-5H2,1-3H3 |
| InChIKey | CZDQGRGYVBYLHA-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|