C11H16O3 — CID 140994820
1-(2-phenylethoxy)propane-1,2-diol (PubChem CID 140994820) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is 1-(2-phenylethoxy)propane-1,2-diol.
| Compound Name | 1-(2-phenylethoxy)propane-1,2-diol |
|---|---|
| PubChem CID | 140994820 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 1-(2-phenylethoxy)propane-1,2-diol |
| SMILES | CC(O)C(O)OCCc1ccccc1 |
| InChI | InChI=1S/C11H16O3/c1-9(12)11(13)14-8-7-10-5-3-2-4-6-10/h2-6,9,11-13H,7-8H2,1H3 |
| InChIKey | JCAOFUTYCCGDAH-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|