C6H18O2Sn — CID 87529398
1,1-diethoxyethane;stannane (PubChem CID 87529398) has the molecular formula C6H18O2Sn and a molecular weight of 240.92 g/mol. Its IUPAC name is 1,1-diethoxyethane;stannane.
| Compound Name | 1,1-diethoxyethane;stannane |
|---|---|
| PubChem CID | 87529398 |
| Molecular Formula | C6H18O2Sn |
| Molecular Weight | 240.92 g/mol |
| Exact Mass | 242.03 |
| IUPAC Name | 1,1-diethoxyethane;stannane |
| SMILES | CCOC(C)OCC.[SnH4] |
| InChI | InChI=1S/C6H14O2.Sn.4H/c1-4-7-6(3)8-5-2;;;;;/h6H,4-5H2,1-3H3;;;;; |
| InChIKey | DDJWESRBLWQOTL-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.92 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|