About cyclopropane;1,1-diethoxyethane
cyclopropane;1,1-diethoxyethane (PubChem CID 67020569) has the molecular formula C9H20O2
and a molecular weight of 160.26 g/mol. Its IUPAC name is cyclopropane;1,1-diethoxyethane.
Molecular Properties
| Compound Name | cyclopropane;1,1-diethoxyethane |
| PubChem CID | 67020569 |
| Molecular Formula | C9H20O2 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.15 |
| IUPAC Name | cyclopropane;1,1-diethoxyethane |
| SMILES | C1CC1.CCOC(C)OCC |
| InChI | InChI=1S/C6H14O2.C3H6/c1-4-7-6(3)8-5-2;1-2-3-1/h6H,4-5H2,1-3H3;1-3H2 |
| InChIKey | OGOQYFGGPJEKHC-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze cyclopropane;1,1-diethoxyethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropane;1,1-diethoxyethane?
The IUPAC name of cyclopropane;1,1-diethoxyethane (CID 67020569) is cyclopropane;1,1-diethoxyethane.
What is the SMILES notation for cyclopropane;1,1-diethoxyethane?
The canonical SMILES for cyclopropane;1,1-diethoxyethane is C1CC1.CCOC(C)OCC.
What is the InChIKey of cyclopropane;1,1-diethoxyethane?
The InChIKey is OGOQYFGGPJEKHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O2.C3H6/c1-4-7-6(3)8-5-2;1-2-3-1/h6H,4-5H2,1-3H3;1-3H2.
What are the key properties of cyclopropane;1,1-diethoxyethane?
cyclopropane;1,1-diethoxyethane has a molecular weight of 160.26 g/mol, XLogP of 2.58, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropane;1,1-diethoxyethane is sourced from PubChem (CID 67020569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).