C12H25BrO3 — CID 87882353
2-bromopropanal;cyclopropane;1,1-diethoxyethane (PubChem CID 87882353) has the molecular formula C12H25BrO3 and a molecular weight of 297.23 g/mol. Its IUPAC name is 2-bromopropanal;cyclopropane;1,1-diethoxyethane.
| Compound Name | 2-bromopropanal;cyclopropane;1,1-diethoxyethane |
|---|---|
| PubChem CID | 87882353 |
| Molecular Formula | C12H25BrO3 |
| Molecular Weight | 297.23 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 2-bromopropanal;cyclopropane;1,1-diethoxyethane |
| SMILES | C1CC1.CC(Br)C=O.CCOC(C)OCC |
| InChI | InChI=1S/C6H14O2.C3H5BrO.C3H6/c1-4-7-6(3)8-5-2;1-3(4)2-5;1-2-3-1/h6H,4-5H2,1-3H3;2-3H,1H3;1-3H2 |
| InChIKey | UORHPHWJHJQJSM-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.23 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|