C17H34O3 — CID 88595952
2-cyclohexylpropanal;1,1-diethoxyethane;ethene (PubChem CID 88595952) has the molecular formula C17H34O3 and a molecular weight of 286.46 g/mol. Its IUPAC name is 2-cyclohexylpropanal;1,1-diethoxyethane;ethene.
| Compound Name | 2-cyclohexylpropanal;1,1-diethoxyethane;ethene |
|---|---|
| PubChem CID | 88595952 |
| Molecular Formula | C17H34O3 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.25 |
| IUPAC Name | 2-cyclohexylpropanal;1,1-diethoxyethane;ethene |
| SMILES | C=C.CC(C=O)C1CCCCC1.CCOC(C)OCC |
| InChI | InChI=1S/C9H16O.C6H14O2.C2H4/c1-8(7-10)9-5-3-2-4-6-9;1-4-7-6(3)8-5-2;1-2/h7-9H,2-6H2,1H3;6H,4-5H2,1-3H3;1-2H2 |
| InChIKey | OTGQNSBDELAZTI-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|