C18H39NO3 — CID 87889060
3-amino-2-cyclopentylpropanal;butane;1,1-diethoxyethane (PubChem CID 87889060) has the molecular formula C18H39NO3 and a molecular weight of 317.51 g/mol. Its IUPAC name is 3-amino-2-cyclopentylpropanal;butane;1,1-diethoxyethane.
| Compound Name | 3-amino-2-cyclopentylpropanal;butane;1,1-diethoxyethane |
|---|---|
| PubChem CID | 87889060 |
| Molecular Formula | C18H39NO3 |
| Molecular Weight | 317.51 g/mol |
| Exact Mass | 317.29 |
| IUPAC Name | 3-amino-2-cyclopentylpropanal;butane;1,1-diethoxyethane |
| SMILES | CCCC.CCOC(C)OCC.NCC(C=O)C1CCCC1 |
| InChI | InChI=1S/C8H15NO.C6H14O2.C4H10/c9-5-8(6-10)7-3-1-2-4-7;1-4-7-6(3)8-5-2;1-3-4-2/h6-8H,1-5,9H2;6H,4-5H2,1-3H3;3-4H2,1-2H3 |
| InChIKey | UORDILRSFBYRQS-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.51 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|