C12H28O3 — CID 87162704
acetaldehyde;butane;1,1-diethoxyethane (PubChem CID 87162704) has the molecular formula C12H28O3 and a molecular weight of 220.35 g/mol. Its IUPAC name is acetaldehyde;butane;1,1-diethoxyethane.
| Compound Name | acetaldehyde;butane;1,1-diethoxyethane |
|---|---|
| PubChem CID | 87162704 |
| Molecular Formula | C12H28O3 |
| Molecular Weight | 220.35 g/mol |
| Exact Mass | 220.20 |
| IUPAC Name | acetaldehyde;butane;1,1-diethoxyethane |
| SMILES | CC=O.CCCC.CCOC(C)OCC |
| InChI | InChI=1S/C6H14O2.C4H10.C2H4O/c1-4-7-6(3)8-5-2;1-3-4-2;1-2-3/h6H,4-5H2,1-3H3;3-4H2,1-2H3;2H,1H3 |
| InChIKey | SRHKVJFPMWMSRO-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.35 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|