C12H26O3 — CID 87967694
butane;1,1-diethoxyethane;ethenone (PubChem CID 87967694) has the molecular formula C12H26O3 and a molecular weight of 218.34 g/mol. Its IUPAC name is butane;1,1-diethoxyethane;ethenone.
| Compound Name | butane;1,1-diethoxyethane;ethenone |
|---|---|
| PubChem CID | 87967694 |
| Molecular Formula | C12H26O3 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.19 |
| IUPAC Name | butane;1,1-diethoxyethane;ethenone |
| SMILES | C=C=O.CCCC.CCOC(C)OCC |
| InChI | InChI=1S/C6H14O2.C4H10.C2H2O/c1-4-7-6(3)8-5-2;1-3-4-2;1-2-3/h6H,4-5H2,1-3H3;3-4H2,1-2H3;1H2 |
| InChIKey | VZORYJFYKIPMPZ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|