C6H16O2S — CID 87563963
1,1-diethoxyethane;sulfane (PubChem CID 87563963) has the molecular formula C6H16O2S and a molecular weight of 152.26 g/mol. Its IUPAC name is 1,1-diethoxyethane;sulfane.
| Compound Name | 1,1-diethoxyethane;sulfane |
|---|---|
| PubChem CID | 87563963 |
| Molecular Formula | C6H16O2S |
| Molecular Weight | 152.26 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | 1,1-diethoxyethane;sulfane |
| SMILES | CCOC(C)OCC.S |
| InChI | InChI=1S/C6H14O2.H2S/c1-4-7-6(3)8-5-2;/h6H,4-5H2,1-3H3;1H2 |
| InChIKey | OWQURMGKBNMUKM-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.26 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|