C10H26O5 — CID 90107522
1,1-diethoxyethane;methane;propane-1,2,3-triol (PubChem CID 90107522) has the molecular formula C10H26O5 and a molecular weight of 226.31 g/mol. Its IUPAC name is 1,1-diethoxyethane;methane;propane-1,2,3-triol.
| Compound Name | 1,1-diethoxyethane;methane;propane-1,2,3-triol |
|---|---|
| PubChem CID | 90107522 |
| Molecular Formula | C10H26O5 |
| Molecular Weight | 226.31 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | 1,1-diethoxyethane;methane;propane-1,2,3-triol |
| SMILES | C.CCOC(C)OCC.OCC(O)CO |
| InChI | InChI=1S/C6H14O2.C3H8O3.CH4/c1-4-7-6(3)8-5-2;4-1-3(6)2-5;/h6H,4-5H2,1-3H3;3-6H,1-2H2;1H4 |
| InChIKey | BMFSURYFVQXWGE-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.31 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|