C17H30O6 — CID 87067731
1,1-diethoxyethane;2-phenylacetaldehyde;propane-1,2,3-triol (PubChem CID 87067731) has the molecular formula C17H30O6 and a molecular weight of 330.42 g/mol. Its IUPAC name is 1,1-diethoxyethane;2-phenylacetaldehyde;propane-1,2,3-triol.
| Compound Name | 1,1-diethoxyethane;2-phenylacetaldehyde;propane-1,2,3-triol |
|---|---|
| PubChem CID | 87067731 |
| Molecular Formula | C17H30O6 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | 1,1-diethoxyethane;2-phenylacetaldehyde;propane-1,2,3-triol |
| SMILES | CCOC(C)OCC.O=CCc1ccccc1.OCC(O)CO |
| InChI | InChI=1S/C8H8O.C6H14O2.C3H8O3/c9-7-6-8-4-2-1-3-5-8;1-4-7-6(3)8-5-2;4-1-3(6)2-5/h1-5,7H,6H2;6H,4-5H2,1-3H3;3-6H,1-2H2 |
| InChIKey | YSHVUHBGQXUGFG-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|