C12H20O5 — CID 157415371
1-phenylmethoxyethanol;propane-1,2,3-triol (PubChem CID 157415371) has the molecular formula C12H20O5 and a molecular weight of 244.29 g/mol. Its IUPAC name is 1-phenylmethoxyethanol;propane-1,2,3-triol.
| Compound Name | 1-phenylmethoxyethanol;propane-1,2,3-triol |
|---|---|
| PubChem CID | 157415371 |
| Molecular Formula | C12H20O5 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 1-phenylmethoxyethanol;propane-1,2,3-triol |
| SMILES | CC(O)OCc1ccccc1.OCC(O)CO |
| InChI | InChI=1S/C9H12O2.C3H8O3/c1-8(10)11-7-9-5-3-2-4-6-9;4-1-3(6)2-5/h2-6,8,10H,7H2,1H3;3-6H,1-2H2 |
| InChIKey | BOTZIDODFNXJHK-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|