C14H22O6 — CID 174419324
6-phenylmethoxyheptane-1,2,3,4,5-pentol (PubChem CID 174419324) has the molecular formula C14H22O6 and a molecular weight of 286.32 g/mol. Its IUPAC name is 6-phenylmethoxyheptane-1,2,3,4,5-pentol.
| Compound Name | 6-phenylmethoxyheptane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 174419324 |
| Molecular Formula | C14H22O6 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 6-phenylmethoxyheptane-1,2,3,4,5-pentol |
| SMILES | CC(OCc1ccccc1)C(O)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C14H22O6/c1-9(20-8-10-5-3-2-4-6-10)12(17)14(19)13(18)11(16)7-15/h2-6,9,11-19H,7-8H2,1H3 |
| InChIKey | BSNDNTLYTPUQHS-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |