C13H20O6 — CID 159388961
(2S,3S,4S,5S)-7-phenylheptane-1,2,3,4,5,6-hexol (PubChem CID 159388961) has the molecular formula C13H20O6 and a molecular weight of 272.30 g/mol. Its IUPAC name is (2S,3S,4S,5S)-7-phenylheptane-1,2,3,4,5,6-hexol.
| Compound Name | (2S,3S,4S,5S)-7-phenylheptane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 159388961 |
| Molecular Formula | C13H20O6 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | (2S,3S,4S,5S)-7-phenylheptane-1,2,3,4,5,6-hexol |
| SMILES | OC[C@H](O)[C@H](O)[C@@H](O)[C@@H](O)C(O)Cc1ccccc1 |
| InChI | InChI=1S/C13H20O6/c14-7-10(16)12(18)13(19)11(17)9(15)6-8-4-2-1-3-5-8/h1-5,9-19H,6-7H2/t9?,10-,11-,12-,13-/m0/s1 |
| InChIKey | DJDIILGJVQYTGX-BGZSDMPXSA-N |
| XLogP | -1.97 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |