C11H16O3 — CID 13198346
(2S,3S)-3-benzylbutane-1,2,4-triol (PubChem CID 13198346) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is (2S,3S)-3-benzylbutane-1,2,4-triol.
| Compound Name | (2S,3S)-3-benzylbutane-1,2,4-triol |
|---|---|
| PubChem CID | 13198346 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | (2S,3S)-3-benzylbutane-1,2,4-triol |
| SMILES | OC[C@H](Cc1ccccc1)[C@H](O)CO |
| InChI | InChI=1S/C11H16O3/c12-7-10(11(14)8-13)6-9-4-2-1-3-5-9/h1-5,10-14H,6-8H2/t10-,11+/m0/s1 |
| InChIKey | CAUOBMYAGJXTNH-WDEREUQCSA-N |
| XLogP | 0.19 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |