C10H13NO4 — CID 174640463
2-nitro-4-phenylbutane-1,3-diol (PubChem CID 174640463) has the molecular formula C10H13NO4 and a molecular weight of 211.22 g/mol. Its IUPAC name is 2-nitro-4-phenylbutane-1,3-diol.
| Compound Name | 2-nitro-4-phenylbutane-1,3-diol |
|---|---|
| PubChem CID | 174640463 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 2-nitro-4-phenylbutane-1,3-diol |
| SMILES | O=[N+]([O-])C(CO)C(O)Cc1ccccc1 |
| InChI | InChI=1S/C10H13NO4/c12-7-9(11(14)15)10(13)6-8-4-2-1-3-5-8/h1-5,9-10,12-13H,6-7H2 |
| InChIKey | UVWIVUXDEXYYSS-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|