C9H10BrNO4 — CID 150861933
(1R,2R)-1-(2-bromophenyl)-2-nitropropane-1,3-diol (PubChem CID 150861933) has the molecular formula C9H10BrNO4 and a molecular weight of 276.09 g/mol. Its IUPAC name is (1R,2R)-1-(2-bromophenyl)-2-nitropropane-1,3-diol.
| Compound Name | (1R,2R)-1-(2-bromophenyl)-2-nitropropane-1,3-diol |
|---|---|
| PubChem CID | 150861933 |
| Molecular Formula | C9H10BrNO4 |
| Molecular Weight | 276.09 g/mol |
| Exact Mass | 274.98 |
| IUPAC Name | (1R,2R)-1-(2-bromophenyl)-2-nitropropane-1,3-diol |
| SMILES | O=[N+]([O-])[C@H](CO)[C@H](O)c1ccccc1Br |
| InChI | InChI=1S/C9H10BrNO4/c10-7-4-2-1-3-6(7)9(13)8(5-12)11(14)15/h1-4,8-9,12-13H,5H2/t8-,9-/m1/s1 |
| InChIKey | KSFGXVUPYFBFMY-RKDXNWHRSA-N |
| XLogP | 1.12 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.09 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|