C10H11BrO4 — CID 11543647
(3S,4R)-4-(2-bromophenyl)-1,3,4-trihydroxybutan-2-one (PubChem CID 11543647) has the molecular formula C10H11BrO4 and a molecular weight of 275.10 g/mol. Its IUPAC name is (3S,4R)-4-(2-bromophenyl)-1,3,4-trihydroxybutan-2-one.
| Compound Name | (3S,4R)-4-(2-bromophenyl)-1,3,4-trihydroxybutan-2-one |
|---|---|
| PubChem CID | 11543647 |
| Molecular Formula | C10H11BrO4 |
| Molecular Weight | 275.10 g/mol |
| Exact Mass | 273.98 |
| IUPAC Name | (3S,4R)-4-(2-bromophenyl)-1,3,4-trihydroxybutan-2-one |
| SMILES | O=C(CO)[C@@H](O)[C@H](O)c1ccccc1Br |
| InChI | InChI=1S/C10H11BrO4/c11-7-4-2-1-3-6(7)9(14)10(15)8(13)5-12/h1-4,9-10,12,14-15H,5H2/t9-,10-/m1/s1 |
| InChIKey | DYHMQXSIXGIHGO-NXEZZACHSA-N |
| XLogP | 0.40 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.10 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |