C14H14O4 — CID 102281218
1,3,4-trihydroxy-4-naphthalen-1-ylbutan-2-one (PubChem CID 102281218) has the molecular formula C14H14O4 and a molecular weight of 246.26 g/mol. Its IUPAC name is 1,3,4-trihydroxy-4-naphthalen-1-ylbutan-2-one.
| Compound Name | 1,3,4-trihydroxy-4-naphthalen-1-ylbutan-2-one |
|---|---|
| PubChem CID | 102281218 |
| Molecular Formula | C14H14O4 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 1,3,4-trihydroxy-4-naphthalen-1-ylbutan-2-one |
| SMILES | O=C(CO)C(O)C(O)c1cccc2ccccc12 |
| InChI | InChI=1S/C14H14O4/c15-8-12(16)14(18)13(17)11-7-3-5-9-4-1-2-6-10(9)11/h1-7,13-15,17-18H,8H2 |
| InChIKey | JONWOOMZFFDAAM-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |