C12H10Cl2O — CID 164892097
2,2-dichloro-1-naphthalen-1-ylethanol (PubChem CID 164892097) has the molecular formula C12H10Cl2O and a molecular weight of 241.12 g/mol. Its IUPAC name is 2,2-dichloro-1-naphthalen-1-ylethanol.
| Compound Name | 2,2-dichloro-1-naphthalen-1-ylethanol |
|---|---|
| PubChem CID | 164892097 |
| Molecular Formula | C12H10Cl2O |
| Molecular Weight | 241.12 g/mol |
| Exact Mass | 240.01 |
| IUPAC Name | 2,2-dichloro-1-naphthalen-1-ylethanol |
| SMILES | OC(c1cccc2ccccc12)C(Cl)Cl |
| InChI | InChI=1S/C12H10Cl2O/c13-12(14)11(15)10-7-3-5-8-4-1-2-6-9(8)10/h1-7,11-12,15H |
| InChIKey | HWIPCFXMDMBZGM-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.12 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|