C15H18O2 — CID 140608407
3-naphthalen-1-ylpentane-2,4-diol (PubChem CID 140608407) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is 3-naphthalen-1-ylpentane-2,4-diol.
| Compound Name | 3-naphthalen-1-ylpentane-2,4-diol |
|---|---|
| PubChem CID | 140608407 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 3-naphthalen-1-ylpentane-2,4-diol |
| SMILES | CC(O)C(c1cccc2ccccc12)C(C)O |
| InChI | InChI=1S/C15H18O2/c1-10(16)15(11(2)17)14-9-5-7-12-6-3-4-8-13(12)14/h3-11,15-17H,1-2H3 |
| InChIKey | OJFQCQAZIUSDAS-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |