About dihydroxy(oxo)phosphanium;1-propan-2-ylnaphthalene
dihydroxy(oxo)phosphanium;1-propan-2-ylnaphthalene (PubChem CID 68581235) has the molecular formula C13H16O3P+
and a molecular weight of 251.24 g/mol. Its IUPAC name is dihydroxy(oxo)phosphanium;1-propan-2-ylnaphthalene.
Molecular Properties
| Compound Name | dihydroxy(oxo)phosphanium;1-propan-2-ylnaphthalene |
| PubChem CID | 68581235 |
| Molecular Formula | C13H16O3P+ |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | dihydroxy(oxo)phosphanium;1-propan-2-ylnaphthalene |
| SMILES | CC(C)c1cccc2ccccc12.O=[P+](O)O |
| InChI | InChI=1S/C13H14.HO3P/c1-10(2)12-9-5-7-11-6-3-4-8-13(11)12;1-4(2)3/h3-10H,1-2H3;(H-,1,2,3)/p+1 |
| InChIKey | OQWSHEFHWIULNG-UHFFFAOYSA-O |
| XLogP | 3.59 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dihydroxy(oxo)phosphanium;1-propan-2-ylnaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihydroxy(oxo)phosphanium;1-propan-2-ylnaphthalene?
The IUPAC name of dihydroxy(oxo)phosphanium;1-propan-2-ylnaphthalene (CID 68581235) is dihydroxy(oxo)phosphanium;1-propan-2-ylnaphthalene.
What is the SMILES notation for dihydroxy(oxo)phosphanium;1-propan-2-ylnaphthalene?
The canonical SMILES for dihydroxy(oxo)phosphanium;1-propan-2-ylnaphthalene is CC(C)c1cccc2ccccc12.O=[P+](O)O.
What is the InChIKey of dihydroxy(oxo)phosphanium;1-propan-2-ylnaphthalene?
The InChIKey is OQWSHEFHWIULNG-UHFFFAOYSA-O. The full InChI is InChI=1S/C13H14.HO3P/c1-10(2)12-9-5-7-11-6-3-4-8-13(11)12;1-4(2)3/h3-10H,1-2H3;(H-,1,2,3)/p+1.
What are the key properties of dihydroxy(oxo)phosphanium;1-propan-2-ylnaphthalene?
dihydroxy(oxo)phosphanium;1-propan-2-ylnaphthalene has a molecular weight of 251.24 g/mol, XLogP of 3.59, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dihydroxy(oxo)phosphanium;1-propan-2-ylnaphthalene is sourced from PubChem (CID 68581235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).