About 1-propan-2-ylnaphthalene;sulfuric acid
1-propan-2-ylnaphthalene;sulfuric acid (PubChem CID 70424781) has the molecular formula C13H16O4S
and a molecular weight of 268.33 g/mol. Its IUPAC name is 1-propan-2-ylnaphthalene;sulfuric acid.
Molecular Properties
| Compound Name | 1-propan-2-ylnaphthalene;sulfuric acid |
| PubChem CID | 70424781 |
| Molecular Formula | C13H16O4S |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 1-propan-2-ylnaphthalene;sulfuric acid |
| SMILES | CC(C)c1cccc2ccccc12.O=S(=O)(O)O |
| InChI | InChI=1S/C13H14.H2O4S/c1-10(2)12-9-5-7-11-6-3-4-8-13(11)12;1-5(2,3)4/h3-10H,1-2H3;(H2,1,2,3,4) |
| InChIKey | ZHGDPPPNNXTFJZ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 1-propan-2-ylnaphthalene;sulfuric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propan-2-ylnaphthalene;sulfuric acid?
The IUPAC name of 1-propan-2-ylnaphthalene;sulfuric acid (CID 70424781) is 1-propan-2-ylnaphthalene;sulfuric acid.
What is the SMILES notation for 1-propan-2-ylnaphthalene;sulfuric acid?
The canonical SMILES for 1-propan-2-ylnaphthalene;sulfuric acid is CC(C)c1cccc2ccccc12.O=S(=O)(O)O.
What is the InChIKey of 1-propan-2-ylnaphthalene;sulfuric acid?
The InChIKey is ZHGDPPPNNXTFJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14.H2O4S/c1-10(2)12-9-5-7-11-6-3-4-8-13(11)12;1-5(2,3)4/h3-10H,1-2H3;(H2,1,2,3,4).
What are the key properties of 1-propan-2-ylnaphthalene;sulfuric acid?
1-propan-2-ylnaphthalene;sulfuric acid has a molecular weight of 268.33 g/mol, XLogP of 3.31, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propan-2-ylnaphthalene;sulfuric acid is sourced from PubChem (CID 70424781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).