C22H18O2 — CID 10470897
(1S,2S)-1,2-dinaphthalen-1-ylethane-1,2-diol (PubChem CID 10470897) has the molecular formula C22H18O2 and a molecular weight of 314.38 g/mol. Its IUPAC name is (1S,2S)-1,2-dinaphthalen-1-ylethane-1,2-diol.
| Compound Name | (1S,2S)-1,2-dinaphthalen-1-ylethane-1,2-diol |
|---|---|
| PubChem CID | 10470897 |
| Molecular Formula | C22H18O2 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | (1S,2S)-1,2-dinaphthalen-1-ylethane-1,2-diol |
| SMILES | O[C@@H](c1cccc2ccccc12)[C@@H](O)c1cccc2ccccc12 |
| InChI | InChI=1S/C22H18O2/c23-21(19-13-5-9-15-7-1-3-11-17(15)19)22(24)20-14-6-10-16-8-2-4-12-18(16)20/h1-14,21-24H/t21-,22-/m0/s1 |
| InChIKey | MNRCSHSTIWDUPJ-VXKWHMMOSA-N |
| XLogP | 4.76 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |