About butane;1-propan-2-ylnaphthalene
butane;1-propan-2-ylnaphthalene (PubChem CID 157253186) has the molecular formula C17H24
and a molecular weight of 228.38 g/mol. Its IUPAC name is butane;1-propan-2-ylnaphthalene.
Molecular Properties
| Compound Name | butane;1-propan-2-ylnaphthalene |
| PubChem CID | 157253186 |
| Molecular Formula | C17H24 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.19 |
| IUPAC Name | butane;1-propan-2-ylnaphthalene |
| SMILES | CC(C)c1cccc2ccccc12.CCCC |
| InChI | InChI=1S/C13H14.C4H10/c1-10(2)12-9-5-7-11-6-3-4-8-13(11)12;1-3-4-2/h3-10H,1-2H3;3-4H2,1-2H3 |
| InChIKey | AWOOJKPGHIPBBN-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze butane;1-propan-2-ylnaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;1-propan-2-ylnaphthalene?
The IUPAC name of butane;1-propan-2-ylnaphthalene (CID 157253186) is butane;1-propan-2-ylnaphthalene.
What is the SMILES notation for butane;1-propan-2-ylnaphthalene?
The canonical SMILES for butane;1-propan-2-ylnaphthalene is CC(C)c1cccc2ccccc12.CCCC.
What is the InChIKey of butane;1-propan-2-ylnaphthalene?
The InChIKey is AWOOJKPGHIPBBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14.C4H10/c1-10(2)12-9-5-7-11-6-3-4-8-13(11)12;1-3-4-2/h3-10H,1-2H3;3-4H2,1-2H3.
What are the key properties of butane;1-propan-2-ylnaphthalene?
butane;1-propan-2-ylnaphthalene has a molecular weight of 228.38 g/mol, XLogP of 5.77, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for butane;1-propan-2-ylnaphthalene is sourced from PubChem (CID 157253186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).