potassium [(1S)-1-naphthalen-1-ylethyl]azanide

C12H12KN — CID 100993742

IUPACpotassium [(1S)-1-naphthalen-1-ylethyl]azanide
SMILESC[C@H]([NH-])c1cccc2ccccc12.[K+]
InChIInChI=1S/C12H12N.K/c1-9(13)11-8-4-6-10-5-2-3-7-12(10)11;/h2-9,13H,1H3;/q-1;+1/t9-;/m0./s1
InChIKeyWNOZRIMQXYPQBG-FVGYRXGTSA-N
MW209.33 g/mol
LogP0.96
Rot. Bonds1

About potassium [(1S)-1-naphthalen-1-ylethyl]azanide

potassium [(1S)-1-naphthalen-1-ylethyl]azanide (PubChem CID 100993742) has the molecular formula C12H12KN and a molecular weight of 209.33 g/mol. Its IUPAC name is potassium [(1S)-1-naphthalen-1-ylethyl]azanide.

Molecular Properties

Compound Namepotassium [(1S)-1-naphthalen-1-ylethyl]azanide
PubChem CID100993742
Molecular FormulaC12H12KN
Molecular Weight209.33 g/mol
Exact Mass209.06
IUPAC Namepotassium [(1S)-1-naphthalen-1-ylethyl]azanide
SMILESC[C@H]([NH-])c1cccc2ccccc12.[K+]
InChIInChI=1S/C12H12N.K/c1-9(13)11-8-4-6-10-5-2-3-7-12(10)11;/h2-9,13H,1H3;/q-1;+1/t9-;/m0./s1
InChIKeyWNOZRIMQXYPQBG-FVGYRXGTSA-N
XLogP0.96
TPSA23.80 Ų
H-Bond Donors
H-Bond Acceptors
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500209.33
LogP ≤ 50.96
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 100

Analyze potassium [(1S)-1-naphthalen-1-ylethyl]azanide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium [(1S)-1-naphthalen-1-ylethyl]azanide?
The IUPAC name of potassium [(1S)-1-naphthalen-1-ylethyl]azanide (CID 100993742) is potassium [(1S)-1-naphthalen-1-ylethyl]azanide.
What is the SMILES notation for potassium [(1S)-1-naphthalen-1-ylethyl]azanide?
The canonical SMILES for potassium [(1S)-1-naphthalen-1-ylethyl]azanide is C[C@H]([NH-])c1cccc2ccccc12.[K+].
What is the InChIKey of potassium [(1S)-1-naphthalen-1-ylethyl]azanide?
The InChIKey is WNOZRIMQXYPQBG-FVGYRXGTSA-N. The full InChI is InChI=1S/C12H12N.K/c1-9(13)11-8-4-6-10-5-2-3-7-12(10)11;/h2-9,13H,1H3;/q-1;+1/t9-;/m0./s1.
What are the key properties of potassium [(1S)-1-naphthalen-1-ylethyl]azanide?
potassium [(1S)-1-naphthalen-1-ylethyl]azanide has a molecular weight of 209.33 g/mol, XLogP of 0.96, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for potassium [(1S)-1-naphthalen-1-ylethyl]azanide is sourced from PubChem (CID 100993742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).