C13H13NO3 — CID 40787446
(2R,3R)-3-azaniumyl-2-hydroxy-3-naphthalen-1-ylpropanoate (PubChem CID 40787446) has the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. Its IUPAC name is (2R,3R)-3-azaniumyl-2-hydroxy-3-naphthalen-1-ylpropanoate.
| Compound Name | (2R,3R)-3-azaniumyl-2-hydroxy-3-naphthalen-1-ylpropanoate |
|---|---|
| PubChem CID | 40787446 |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | (2R,3R)-3-azaniumyl-2-hydroxy-3-naphthalen-1-ylpropanoate |
| SMILES | [NH3+][C@H](c1cccc2ccccc12)[C@@H](O)C(=O)[O-] |
| InChI | InChI=1S/C13H13NO3/c14-11(12(15)13(16)17)10-7-3-5-8-4-1-2-6-9(8)10/h1-7,11-12,15H,14H2,(H,16,17)/t11-,12-/m1/s1 |
| InChIKey | JWGUPWBKDSQFQO-VXGBXAGGSA-N |
| XLogP | -0.77 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |