C16H19NO6 — CID 158376535
2,3-dihydroxybutanedioic acid;(1R)-1-naphthalen-1-ylethanamine (PubChem CID 158376535) has the molecular formula C16H19NO6 and a molecular weight of 321.33 g/mol. Its IUPAC name is 2,3-dihydroxybutanedioic acid;(1R)-1-naphthalen-1-ylethanamine.
| Compound Name | 2,3-dihydroxybutanedioic acid;(1R)-1-naphthalen-1-ylethanamine |
|---|---|
| PubChem CID | 158376535 |
| Molecular Formula | C16H19NO6 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 2,3-dihydroxybutanedioic acid;(1R)-1-naphthalen-1-ylethanamine |
| SMILES | C[C@@H](N)c1cccc2ccccc12.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C12H13N.C4H6O6/c1-9(13)11-8-4-6-10-5-2-3-7-12(10)11;5-1(3(7)8)2(6)4(9)10/h2-9H,13H2,1H3;1-2,5-6H,(H,7,8)(H,9,10)/t9-;/m1./s1 |
| InChIKey | GVGRBXONPMYDEB-SBSPUUFOSA-N |
| XLogP | 0.74 |
| TPSA | 141.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |