About (1S)-1-(4-bromophenyl)ethanamine;(1S)-1-naphthalen-1-ylethanamine
(1S)-1-(4-bromophenyl)ethanamine;(1S)-1-naphthalen-1-ylethanamine (PubChem CID 22806370) has the molecular formula C20H23BrN2
and a molecular weight of 371.32 g/mol. Its IUPAC name is (1S)-1-(4-bromophenyl)ethanamine;(1S)-1-naphthalen-1-ylethanamine.
Molecular Properties
| Compound Name | (1S)-1-(4-bromophenyl)ethanamine;(1S)-1-naphthalen-1-ylethanamine |
| PubChem CID | 22806370 |
| Molecular Formula | C20H23BrN2 |
| Molecular Weight | 371.32 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | (1S)-1-(4-bromophenyl)ethanamine;(1S)-1-naphthalen-1-ylethanamine |
| SMILES | C[C@H](N)c1ccc(Br)cc1.C[C@H](N)c1cccc2ccccc12 |
| InChI | InChI=1S/C12H13N.C8H10BrN/c1-9(13)11-8-4-6-10-5-2-3-7-12(10)11;1-6(10)7-2-4-8(9)5-3-7/h2-9H,13H2,1H3;2-6H,10H2,1H3/t9-;6-/m00/s1 |
| InChIKey | DWGLKVYICXQCHP-NRDCADONSA-N |
| XLogP | 5.33 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 371.32 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1S)-1-(4-bromophenyl)ethanamine;(1S)-1-naphthalen-1-ylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-(4-bromophenyl)ethanamine;(1S)-1-naphthalen-1-ylethanamine?
The IUPAC name of (1S)-1-(4-bromophenyl)ethanamine;(1S)-1-naphthalen-1-ylethanamine (CID 22806370) is (1S)-1-(4-bromophenyl)ethanamine;(1S)-1-naphthalen-1-ylethanamine.
What is the SMILES notation for (1S)-1-(4-bromophenyl)ethanamine;(1S)-1-naphthalen-1-ylethanamine?
The canonical SMILES for (1S)-1-(4-bromophenyl)ethanamine;(1S)-1-naphthalen-1-ylethanamine is C[C@H](N)c1ccc(Br)cc1.C[C@H](N)c1cccc2ccccc12.
What is the InChIKey of (1S)-1-(4-bromophenyl)ethanamine;(1S)-1-naphthalen-1-ylethanamine?
The InChIKey is DWGLKVYICXQCHP-NRDCADONSA-N. The full InChI is InChI=1S/C12H13N.C8H10BrN/c1-9(13)11-8-4-6-10-5-2-3-7-12(10)11;1-6(10)7-2-4-8(9)5-3-7/h2-9H,13H2,1H3;2-6H,10H2,1H3/t9-;6-/m00/s1.
What are the key properties of (1S)-1-(4-bromophenyl)ethanamine;(1S)-1-naphthalen-1-ylethanamine?
(1S)-1-(4-bromophenyl)ethanamine;(1S)-1-naphthalen-1-ylethanamine has a molecular weight of 371.32 g/mol, XLogP of 5.33, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-(4-bromophenyl)ethanamine;(1S)-1-naphthalen-1-ylethanamine is sourced from PubChem (CID 22806370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).