C14H16N2O3 — CID 174834976
2-aminopropanoic acid;naphthalene-1-carboxamide (PubChem CID 174834976) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is 2-aminopropanoic acid;naphthalene-1-carboxamide.
| Compound Name | 2-aminopropanoic acid;naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 174834976 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 2-aminopropanoic acid;naphthalene-1-carboxamide |
| SMILES | CC(N)C(=O)O.NC(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C11H9NO.C3H7NO2/c12-11(13)10-7-3-5-8-4-1-2-6-9(8)10;1-2(4)3(5)6/h1-7H,(H2,12,13);2H,4H2,1H3,(H,5,6) |
| InChIKey | BRXGDFUZKWYQSA-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |