C14H13NO3 — CID 11637328
(2S)-2-(naphthalene-1-carbonylamino)propanoic acid (PubChem CID 11637328) has the molecular formula C14H13NO3 and a molecular weight of 243.26 g/mol. Its IUPAC name is (2S)-2-(naphthalene-1-carbonylamino)propanoic acid.
| Compound Name | (2S)-2-(naphthalene-1-carbonylamino)propanoic acid |
|---|---|
| PubChem CID | 11637328 |
| Molecular Formula | C14H13NO3 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | (2S)-2-(naphthalene-1-carbonylamino)propanoic acid |
| SMILES | C[C@H](NC(=O)c1cccc2ccccc12)C(=O)O |
| InChI | InChI=1S/C14H13NO3/c1-9(14(17)18)15-13(16)12-8-4-6-10-5-2-3-7-11(10)12/h2-9H,1H3,(H,15,16)(H,17,18)/t9-/m0/s1 |
| InChIKey | XKPDGUIRFZFOCU-VIFPVBQESA-N |
| XLogP | 2.04 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |