C24H25NO4 — CID 69081541
2-[[1-[(2R)-4-phenylbutan-2-yl]oxynaphthalene-2-carbonyl]amino]propanoic acid (PubChem CID 69081541) has the molecular formula C24H25NO4 and a molecular weight of 391.47 g/mol. Its IUPAC name is 2-[[1-[(2R)-4-phenylbutan-2-yl]oxynaphthalene-2-carbonyl]amino]propanoic acid.
| Compound Name | 2-[[1-[(2R)-4-phenylbutan-2-yl]oxynaphthalene-2-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 69081541 |
| Molecular Formula | C24H25NO4 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | 2-[[1-[(2R)-4-phenylbutan-2-yl]oxynaphthalene-2-carbonyl]amino]propanoic acid |
| SMILES | CC(NC(=O)c1ccc2ccccc2c1O[C@H](C)CCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C24H25NO4/c1-16(12-13-18-8-4-3-5-9-18)29-22-20-11-7-6-10-19(20)14-15-21(22)23(26)25-17(2)24(27)28/h3-11,14-17H,12-13H2,1-2H3,(H,25,26)(H,27,28)/t16-,17?/m1/s1 |
| InChIKey | NRGXSQCVTHBVSX-TZHYSIJRSA-N |
| XLogP | 4.44 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |