C13H14O2 — CID 154706330
(1S)-1-naphthalen-1-ylpropane-1,3-diol (PubChem CID 154706330) has the molecular formula C13H14O2 and a molecular weight of 202.25 g/mol. Its IUPAC name is (1S)-1-naphthalen-1-ylpropane-1,3-diol.
| Compound Name | (1S)-1-naphthalen-1-ylpropane-1,3-diol |
|---|---|
| PubChem CID | 154706330 |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | (1S)-1-naphthalen-1-ylpropane-1,3-diol |
| SMILES | OCC[C@H](O)c1cccc2ccccc12 |
| InChI | InChI=1S/C13H14O2/c14-9-8-13(15)12-7-3-5-10-4-1-2-6-11(10)12/h1-7,13-15H,8-9H2/t13-/m0/s1 |
| InChIKey | BGGNLVFWUUBPQS-ZDUSSCGKSA-N |
| XLogP | 2.26 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |