C10H9BrO3 — CID 69126209
1-(2-bromophenyl)-1-hydroxybutane-2,3-dione (PubChem CID 69126209) has the molecular formula C10H9BrO3 and a molecular weight of 257.08 g/mol. Its IUPAC name is 1-(2-bromophenyl)-1-hydroxybutane-2,3-dione.
| Compound Name | 1-(2-bromophenyl)-1-hydroxybutane-2,3-dione |
|---|---|
| PubChem CID | 69126209 |
| Molecular Formula | C10H9BrO3 |
| Molecular Weight | 257.08 g/mol |
| Exact Mass | 255.97 |
| IUPAC Name | 1-(2-bromophenyl)-1-hydroxybutane-2,3-dione |
| SMILES | CC(=O)C(=O)C(O)c1ccccc1Br |
| InChI | InChI=1S/C10H9BrO3/c1-6(12)9(13)10(14)7-4-2-3-5-8(7)11/h2-5,10,14H,1H3 |
| InChIKey | HDVIDGHETXJVLK-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.08 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|