C8H10N2O4 — CID 93003157
(1S,2R)-2-nitro-1-pyridin-4-ylpropane-1,3-diol (PubChem CID 93003157) has the molecular formula C8H10N2O4 and a molecular weight of 198.18 g/mol. Its IUPAC name is (1S,2R)-2-nitro-1-pyridin-4-ylpropane-1,3-diol.
| Compound Name | (1S,2R)-2-nitro-1-pyridin-4-ylpropane-1,3-diol |
|---|---|
| PubChem CID | 93003157 |
| Molecular Formula | C8H10N2O4 |
| Molecular Weight | 198.18 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | (1S,2R)-2-nitro-1-pyridin-4-ylpropane-1,3-diol |
| SMILES | O=[N+]([O-])[C@H](CO)[C@@H](O)c1ccncc1 |
| InChI | InChI=1S/C8H10N2O4/c11-5-7(10(13)14)8(12)6-1-3-9-4-2-6/h1-4,7-8,11-12H,5H2/t7-,8+/m1/s1 |
| InChIKey | LKKGQHPPEZLYSG-SFYZADRCSA-N |
| XLogP | -0.25 |
| TPSA | 96.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.18 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|