C11H17NO3 — CID 71195072
3-[hydroxy(pyridin-4-yl)methyl]pentane-1,5-diol (PubChem CID 71195072) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is 3-[hydroxy(pyridin-4-yl)methyl]pentane-1,5-diol.
| Compound Name | 3-[hydroxy(pyridin-4-yl)methyl]pentane-1,5-diol |
|---|---|
| PubChem CID | 71195072 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 3-[hydroxy(pyridin-4-yl)methyl]pentane-1,5-diol |
| SMILES | OCCC(CCO)C(O)c1ccncc1 |
| InChI | InChI=1S/C11H17NO3/c13-7-3-10(4-8-14)11(15)9-1-5-12-6-2-9/h1-2,5-6,10-11,13-15H,3-4,7-8H2 |
| InChIKey | UWGRTHAQYINGIN-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |